Name |
Myricetin-3-O-rutinoside Myricetin 3-rutinoside Myricetin-3-rutinoside |
Formula |
C27H30O17 |
Mw |
626.14829954 |
CAS RN |
41093-68-9 |
C_ID |
C00005737
, 
|
InChIKey |
QCIILLDRJZPUDI-CGEILPHONA-N |
InChICode |
InChI=1S/C27H30O17/c1-7-16(32)20(36)22(38)26(41-7)40-6-14-18(34)21(37)23(39)27(43-14)44-25-19(35)15-10(29)4-9(28)5-13(15)42-24(25)8-2-11(30)17(33)12(31)3-8/h2-5,7,14,16,18,20-23,26-34,36-39H,6H2,1H3/t7-,14+,16+,18-,20+,21-,22-,23+,26-,27+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)C)O)O)O)O)O)O)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cephalotaceae | Cephalotus follicularis | Ref. |
Plantae | Cistaceae | Cistus ladaniferus  | Ref. |
Plantae | Fabaceae | Acacia dealbata | Ref. |
Plantae | Fabaceae | Clitoria ternatea  | Ref. |
Plantae | Fabaceae | Onobrychis viciifolia  | Ref. |
Plantae | Fabaceae | Peltophorum africanum  | Ref. |
Plantae | Geraniaceae | Geranium mascatense | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Grossulariaceae | Ribes spp.  | Ref. |
Plantae | Limnanthaceae | Limnanthes douglasii | Ref. |
Plantae | Marantaceae | Calathea angustifolia | Ref. |
Plantae | Plumbaginaceae | Limonium gmelinii  | Ref. |
Plantae | Rhizophoraceae | Bruguiera sexangula var.rhynchopetala | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
Plantae | Solanaceae | Solanum soukupii | Ref. |
Plantae | Typhaceae/Sparganiaceae | Sparganium erectum | Ref. |
|
|
zoom in
Organism | Ginkgo biloba | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Baruah,J.Sci.Food Agric.,10,(1959),125
Williams,Phytochem.,10,(1971),1059 |
---|
|