Name |
Isolariciresinol (+)-Isolariciresinol |
Formula |
C20H24O6 |
Mw |
360.1572885 |
CAS RN |
548-29-8 |
C_ID |
C00007204
,
|
InChIKey |
OGFXBIXJCWAUCH-ALOORJTLNA-N |
InChICode |
InChI=1S/C20H24O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-4,6-8,13,15,20-24H,5,9-10H2,1-2H3/t13-,15+,20-/m0/s1 |
SMILES |
Oc1c(cc2C[C@H]([C@H]([C@H](c2c1)c1ccc(c(c1)OC)O)CO)CO)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Justicia diffusa var. prostrata | Ref. |
Plantae | Acanthaceae | Justicia flava | Ref. |
Plantae | Acanthaceae | Justicia glauca | Ref. |
Plantae | Acanthaceae | Justicia tranquebariensis | Ref. |
Plantae | Apocynaceae | Melodinus morsei | Ref. |
Plantae | Araucariaceae | Araucaria angustifolia | Ref. |
Plantae | Betulaceae | Betula pendula | Ref. |
Plantae | Burseraceae | Bursera tonkinensis | Ref. |
Plantae | Celastraceae | Salacia prinoides | Ref. |
Plantae | Celastraceae | Tripterygium regelii | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
Plantae | Cruciferae | Isatis indigotica | Ref. |
Plantae | Cupressaceae | Fitzroya cupressoides | Ref. |
Plantae | Cynomoriaceae | Cynomorium songaricum | Ref. |
Plantae | Ericaceae | Gaultheria yunnanensis | Ref. |
Plantae | Fabaceae | Bauhinia tarapotensis | Ref. |
Plantae | Gentianaceae | Fagraea racemosa | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Heritiera littoralis | Ref. |
Plantae | Menispermaceae | Tinospora smilacina | Ref. |
Plantae | Pinaceae | Abies sachalinensis | Ref. |
Plantae | Pinaceae | Larix dahurica | Ref. |
Plantae | Pinaceae | Larix leptolepis | Ref. |
Plantae | Pinaceae | Larix olgensis var. koreana | Ref. |
Plantae | Pinaceae | Larix sibirica | Ref. |
Plantae | Pinaceae | Picea excelsa | Ref. |
Plantae | Pinaceae | Pinus massoniana | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pinus sylvestris | Ref. |
Plantae | Podocarpaceae | Podocarpus spicatus | Ref. |
Plantae | Ranunculaceae | Coptis japonica var. dissecta | Ref. |
Plantae | Resedaceae | Reseda suffruticosa | Ref. |
Plantae | Rubiaceae | Hedyotis chrysotricha | Ref. |
Plantae | Rubiaceae | Mitragyna africanus WILLD. | Ref. |
Plantae | Rubiaceae | Rubia akane | Ref. |
Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
Plantae | Schisandraceae | Schisandra nigra | Ref. |
Plantae | Symplocaceae | Symplocos lancifolia | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Taxaceae | Taxus brevifolia | Ref. |
Plantae | Taxaceae | Taxus cuspidata | Ref. |
Plantae | Taxaceae | Taxus floridana | Ref. |
Plantae | Taxaceae | Taxus mairei | Ref. |
Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
Plantae | Thymelaeaceae | Daphne feddei | Ref. |
Plantae | Thymelaeaceae | Wikstroemia glabra | Ref. |
Plantae | Ulmaceae | Ulmus davidiana var. japonica | Ref. |
Plantae | Urticaceae | Urtica dioica | Ref. |
Plantae | Verbenaceae | Lippia sidoides | Ref. |
|
|
zoom in
Organism | Bursera tonkinensis | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
TAO, et al., Chem Pharm Bull, 51, (2003), 654.
KISHI, et al., Chem Pharm Bull, 51, (2003), 1051.
Morikawa, et al., Journal of Natural Products, 66, (2003), 638.
Jutiviboonsuk, et al., Phytochemistry, 66, (2005), 2745 |
---|
|