Name |
p-Coumaric acid p-Coumarate 4-Coumarate 4-coumaric acid |
Formula |
C9H8O3 |
Mw |
164.04734412 |
CAS RN |
7400-08-0 |
C_ID |
C00000152
,
|
InChIKey |
NGSWKAQJJWESNS-ZZXKWVIFSA-N |
InChICode |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
SMILES |
c1c(ccc(c1)/C=C/C(=O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acoraceae | Acorus calamus | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Annonaceae | Cananga latifolia | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Aquifoliaceae | Ilex paraguariensis | Ref. |
Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Asteraceae | Chrysanthemum boreale | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
Plantae | Bignoniaceae | Catalpa ovata | Ref. |
Plantae | Bignoniaceae | Stereospermum zenkeri | Ref. |
Plantae | Boraginaceae | Lithospermum erythrorhizon | Ref. |
Plantae | Bromeliaceae | Ananas comosus | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Chenopodiaceae | Beta vulgaris L. var. saccharifera | Ref. |
Plantae | Chloranthaceae | Sarcandra glabra | Ref. |
Plantae | Commelinaceae | Dichorisandra thyrsiflora | Ref. |
Plantae | Convolvulaceae | Cuscuta australis | Ref. |
Plantae | Crassulaceae | Bryophyllum pinnatum | Ref. |
Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica napus | Ref. |
Plantae | Cruciferae | Brassica oleracea var. gongylodes | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cyperaceae | Cyperus papyrus | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Ephedraceae | Ephedra alata | Ref. |
Plantae | Ephedraceae | Ephedra equisetina | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lens esculenta | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Melilotus messanensis | Ref. |
Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Trifolium alpestre | Ref. |
Plantae | Fabaceae | Trifolium medium | Ref. |
Plantae | Fabaceae | Trifolium pratense L. | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Haemodoraceae | Anigozanthos preissii | Ref. |
Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Juncaceae | Juncus inflexus | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Mentha piperitae | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum sanctum | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Liliaceae | Notholirion hyacinthium | Ref. |
Plantae | Lygodiaceae/Schizaeaceae | Lygodium japonicum | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Malvaceae | Althaea nudiflora | Ref. |
Plantae | Malvaceae | Althaea rosea | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Malvaceae | Malva silvestris | Ref. |
Plantae | Myrtaceae | Eucalyptus maculata | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Oleaceae | Syringa oblata | Ref. |
Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
Plantae | Palmae | Phoenix canariensis | Ref. |
Plantae | Pinaceae | Picea ajanensis | Ref. |
Plantae | Pinaceae | Picea obovata | Ref. |
Plantae | Pinaceae | Pinus radiata | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Plantago media | Ref. |
Plantae | Poaceae | Gynerium sagittatum | Ref. |
Plantae | Poaceae | Maize bran | Ref. |
Plantae | Poaceae | Panicum virgatum | Ref. |
Plantae | Poaceae | Phyllostachys edulis | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
Plantae | Ranunculaceae | Actaea racemosa | Ref. |
Plantae | Ranunculaceae | Ranunculus baudotii | Ref. |
Plantae | Restionaceae | Baloskion tetraphyllum | Ref. |
Plantae | Restionaceae | Elegia capensis | Ref. |
Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
Plantae | Rosaceae | Cowania mexicana | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus serotina | Ref. |
Plantae | Rosaceae | Spiraea formosana | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
Plantae | Salicaceae | Populus deltoides | Ref. |
Plantae | Salicaceae | Populus spp. | Ref. |
Plantae | Salicaceae | Populus trichocarpa | Ref. |
Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Strelitziaceae | Strelitzia reginae | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Typhaceae | Typha domingensis P. | Ref. |
Plantae | Typhaceae | Typha orientalis | Ref. |
Plantae | Typhaceae/Sparganiaceae | Sparganium stoloniferum | Ref. |
Plantae | Vitaceae | Vitis rupestris | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zingiberaceae | Alpinia blepharocalyx | Ref. |
Plantae | Zingiberaceae | Curcuma domestica | Ref. |
Plantae | Zingiberaceae | Hedychium gardnerianum | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata | Ref. |
- | - | Ephedar aphylla | Ref. |
- | - | Equsetum arvense | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Sarcolaeana multiflora | Ref. |
- | - | Scrophularis sambucifolia | Ref. |
|
|
zoom in
Organism | Syringa oblata | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Kim, et al., Planta Med, 69, (2003), 274.
McNally, et al., Journal of Natural Products, 66, (2003), 1280.
Wu, et al., Journal of Natural Products, 66, (2003), 996.
CHIU, et al., Chem Pharm Bull, 53, (2005), 1118.
Kim, et al., Phytochemistry, 54, (2000), 503.
Ali, et al., Journal of Natural Products, 64, (2001), 289.
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 548.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
---|
|