| Name |
Vitamin B3
Nicotinic acid
Niacin |
| Formula |
C6H5NO2 |
| Mw |
123.03202841 |
| CAS RN |
59-67-6 |
| C_ID |
C00000208
, 
|
| InChIKey |
PVNIIMVLHYAWGP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9) |
| SMILES |
c1cncc(c1)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Bangiaceae | Porphyra tenera  | Ref. |
| Animalia | Bombycidae | Bombyx mori | Ref. |
| Animalia | Bovidae | Bos taurus domesticus | Ref. |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Fungi | Mortierellaceae | Mortierella vinacea | Ref. |
| Plantae | Anacardiaceae | Mangifera indica | Ref. |
| Plantae | Anemarrhenaceae | Anemarrhena asphodeloides | Ref. |
| Plantae | Apiaceae | Angelica sinensis | Ref. |
| Plantae | Araliaceae | Panax ginseng | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis | Ref. |
| Plantae | Cucurbitaceae | Benincasa hispida | Ref. |
| Plantae | Cyprinidae | Cyprinus carpio | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
| Plantae | Fabaceae | Glycine max | Ref. |
| Plantae | Fabaceae | Medicago sativa | Ref. |
| Plantae | Fabaceae | Tamarindus indica | Ref. |
| Plantae | Labiatae | Ajuga taiwanensis | Ref. |
| Plantae | Lauraceae | Cassytha filiformis | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
| Plantae | Solanaceae | Lycium chinense | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum | Ref. |
| - | - | Carpa hircus | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Gallus gallus domesticus | Ref. |
|
|
zoom in
| Organism | Angelica sinensis |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
CHAN, et al., Chem Pharm Bull, 53, (2005), 836 |
|---|
|
