Name |
Cyanidin-3-O-glucoside Cyanidin 3-O-glucoside Chrysanthemin |
Formula |
C21H21O11+ |
Mw |
449.10838652 |
CAS RN |
7084-24-4 |
C_ID |
C00002374
, 
|
InChIKey |
RKWHWFONKJEUEF-DNLILFCWNA-O |
InChICode |
InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26)/p+1/t16-,17-,18+,19-,21-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Adoxaceae | Sambucus canadensis  | Ref. |
Plantae | Alliaceae | Allium cepa  | Ref. |
Plantae | Alliaceae | Allium sativum  | Ref. |
Plantae | Alliaceae | Allium schoenoprasum  | Ref. |
Plantae | Alliaceae | Allium spp. | Ref. |
Plantae | Alliaceae | Allium victorialis  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Asteraceae | Aster spp. | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum  | Ref. |
Plantae | Asteraceae | Helianthus annuus  | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Boraginaceae | Lobostemon spp. | Ref. |
Plantae | Calochortaceae | Tricyrtis formosana | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera caerulea | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
Plantae | Coriariaceae | Coriaria myrtifolia | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus suecica  | Ref. |
Plantae | Crassulaceae | Cotyledon spp. | Ref. |
Plantae | Crassulaceae | Crassula spp. | Ref. |
Plantae | Crassulaceae | Tylecodon spp. | Ref. |
Plantae | Cynomoriaceae | Cynomorium coccineum | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
Plantae | Ericaceae | Vaccinium myrtillus L.  | Ref. |
Plantae | Ericaceae | Vaccinium padifolium | Ref. |
Plantae | Fabaceae | Albizia julibrissin  | Ref. |
Plantae | Fabaceae | Amphithalea spp. | Ref. |
Plantae | Fabaceae | Bauhinia variegata  | Ref. |
Plantae | Fabaceae | Cassia javanica  | Ref. |
Plantae | Fabaceae | Coelidium spp. | Ref. |
Plantae | Fabaceae | Delonix regia  | Ref. |
Plantae | Fabaceae | Erythrina coralloides | Ref. |
Plantae | Fabaceae | Erythrina crista-galli  | Ref. |
Plantae | Fabaceae | Erythrina dominguezii | Ref. |
Plantae | Fabaceae | Erythrina falcata | Ref. |
Plantae | Fabaceae | Erythrina herbacea | Ref. |
Plantae | Fabaceae | Erythrina pudica | Ref. |
Plantae | Fabaceae | Erythrina x bidwillii | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Hypocalyptus spp. | Ref. |
Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
Plantae | Fabaceae | Liparia spp. | Ref. |
Plantae | Fabaceae | Pisum sativum  | Ref. |
Plantae | Fabaceae | Podalyria spp. | Ref. |
Plantae | Fabaceae | Tamarindus indica  | Ref. |
Plantae | Fabaceae | Vigna mungo  | Ref. |
Plantae | Fabaceae | Vigna subterranea  | Ref. |
Plantae | Fabaceae | Virgilia spp. | Ref. |
Plantae | Gentianaceae | Gentiana sp. | Ref. |
Plantae | Geraniaceae | Geranium sylvaticum | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Lardizabalaceae | Akebia trifoliata  | Ref. |
Plantae | Lardizabalaceae | Stauntonia hexaphylla  | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Malvaceae | Sterculia foetida  | Ref. |
Plantae | Moraceae | Ficus carica  | Ref. |
Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
Plantae | Orchidaceae | Dracula chimaera | Ref. |
Plantae | Palmae | Euterpe edulis  | Ref. |
Plantae | Palmae | Pinanga polymorpha | Ref. |
Plantae | Passifloraceae | Passiflora edulis  | Ref. |
Plantae | Passifloraceae | Passiflora suberosa | Ref. |
Plantae | Phrymaceae | Mimulus cardinalis | Ref. |
Plantae | Phrymaceae | Mimulus lewisii | Ref. |
Plantae | Pinaceae | Abies spp. | Ref. |
Plantae | Pinaceae | Pinus banksiana  | Ref. |
Plantae | Pinaceae | Pseudotsuga spp. | Ref. |
Plantae | Pinaceae | Tsuga spp. | Ref. |
Plantae | Poaceae | Alopecurus spp. | Ref. |
Plantae | Poaceae | Anthoxanthum spp. | Ref. |
Plantae | Poaceae | Avenula spp. | Ref. |
Plantae | Poaceae | Bothriochloa spp. | Ref. |
Plantae | Poaceae | Dactylis spp. | Ref. |
Plantae | Poaceae | Deschampsia spp. | Ref. |
Plantae | Poaceae | Elymus spp. | Ref. |
Plantae | Poaceae | Festuca spp. | Ref. |
Plantae | Poaceae | Hordeum spp. | Ref. |
Plantae | Poaceae | Miscanthus spp. | Ref. |
Plantae | Poaceae | Molinia spp. | Ref. |
Plantae | Poaceae | Oryza spp. | Ref. |
Plantae | Poaceae | Pennisetum setaceum | Ref. |
Plantae | Poaceae | Phalaris arundinacea | Ref. |
Plantae | Poaceae | Phleum spp. | Ref. |
Plantae | Poaceae | Phragmites australis  | Ref. |
Plantae | Poaceae | Poa spp. | Ref. |
Plantae | Poaceae | Sinarundinaria spp. | Ref. |
Plantae | Poaceae | Triticum aestivum  | Ref. |
Plantae | Poaceae | Zea mays  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rosaceae | Prunus cerasus  | Ref. |
Plantae | Rosaceae | Rosa spp. | Ref. |
Plantae | Rosaceae | Rubus idaeus  | Ref. |
Plantae | Rubiaceae | Cephaelis subcoriacea | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Sapindaceae | Acer platanoides  | Ref. |
Plantae | Solanaceae | Petunia exserta | Ref. |
Plantae | Ternstroemiaceae | Visnea mocanera | Ref. |
Plantae | Vitaceae | Vitis vinifera  | Ref. |
- | - | FOOD SAKE | Ref. |
|
|
zoom in
Organism | Chrysanthemum indicum | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann.,412,(1916),136 |
---|
|