| Name |
Digiferrugineol
Digiferruginol |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
24094-45-9 |
| C_ID |
C00002814
, 
|
| InChIKey |
JCZCSQSSSAHDCB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-7-8-5-6-11-12(13(8)17)15(19)10-4-2-1-3-9(10)14(11)18/h1-6,16-17H,7H2 |
| SMILES |
c1ccc2c(c1)C(=O)c1c(C2=O)ccc(c1O)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gesneriaceae | Streptocarpus dunnii | Ref. |
| Plantae | Plantaginaceae | Digitalis ferruginea  | Ref. |
| Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
| Plantae | Rubiaceae | Cinchona spp. | Ref. |
| Plantae | Rubiaceae | Damnacanthus indicus | Ref. |
| Plantae | Rubiaceae | Hedyotis capitellata | Ref. |
| Plantae | Rubiaceae | Morinda parvifolia | Ref. |
| Plantae | Rubiaceae | Rubia cordifolia | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana | Ref. |
|
|
zoom in
| Organism | Rubia wallichiana |
|---|
| Reference | WU, et al., Chem Pharm Bull, 51, (2003), 948.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999). |
|---|
|
