Name |
Quercetagetin |
Formula |
C15H10O8 |
Mw |
318.0375673 |
CAS RN |
90-18-6 |
C_ID |
C00004677
,
|
InChIKey |
ZVOLCUVKHLEPEV-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)15-14(22)13(21)10-9(23-15)4-8(18)11(19)12(10)20/h1-4,16-20,22H |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Anthemis spp. | Ref. |
Plantae | Asteraceae | Chrysanthemum spp. | Ref. |
Plantae | Asteraceae | Eupatorium gracile | Ref. |
Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
Plantae | Asteraceae | Leucanthemum atratum | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Rudbeckia hirta | Ref. |
Plantae | Asteraceae | Senecio oryzetorum | Ref. |
Plantae | Asteraceae | Tagetes erecta | Ref. |
Plantae | Asteraceae | Tagetes patula | Ref. |
Plantae | Eriocaulaceae | Eriocaulon spp. | Ref. |
Plantae | Eriocaulaceae | Paepalanthus polyanthus | Ref. |
Plantae | Eriocaulaceae | Paepalanthus ramosus | Ref. |
Plantae | Eriocaulaceae | Paepalanthus robustus | Ref. |
Plantae | Fabaceae | Acacia catechu | Ref. |
Plantae | Fabaceae | Leucaena glauca | Ref. |
|
|
zoom in
Organism | Tagetes erecta | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Baker,J.Chem.Soc.,(1929),74 |
---|
|