Name |
5,6,3',4'-Tetrahydroxy-3,7-dimethoxyflavone Tomentin 3,7-Dimethylquercetagetin 2-(3,4-Dihydroxyphenyl)-5,6-dihydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
Formula |
C17H14O8 |
Mw |
346.06886743 |
CAS RN |
59171-23-2 |
C_ID |
C00004685
, 
|
InChIKey |
WGWGXVOAFMLMJZ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O8/c1-23-11-6-10-12(14(21)13(11)20)15(22)17(24-2)16(25-10)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)O)O)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apocynaceae | Marsdenia tomentosa Decne. | Ref. |
Plantae | Asteraceae | Ambrosia artemisiifolia | Ref. |
Plantae | Asteraceae | Artemisia abrotanum  | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Haplopappus rengifoanus | Ref. |
Plantae | Asteraceae | Holocarpha obconica | Ref. |
Plantae | Asteraceae | Inula germanica  | Ref. |
Plantae | Asteraceae | Madia sativa  | Ref. |
Plantae | Asteraceae | Melampodium americanum | Ref. |
Plantae | Asteraceae | Neurolaena spp. | Ref. |
Plantae | Asteraceae | Parthenium tomentosum | Ref. |
Plantae | Asteraceae | Pterocaulon purpurascens | Ref. |
Plantae | Asteraceae | Pulicaria spp. | Ref. |
Plantae | Asteraceae | Tanacetum parthenium  | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
Plantae | Saxifragaceae | Chrysosplenium tetrandrum | Ref. |
|
|
zoom in
Organism | Melampodium americanum | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wagner,Tetrahedron Lett.,(1976),67
Jay,Phytochem.,15,(1976),517 |
---|
|