| Name |
Tiliroside
Kaempferol 3-O-beta-D-(6''-coumaroyl)-glucopyranoside
Potengriffioside A |
| Formula |
C30H26O13 |
| Mw |
594.13734092 |
| CAS RN |
20316-62-5 |
| C_ID |
C00005851
, 
|
| InChIKey |
DVGGLGXQSFURLP-PMXORBILNA-N |
| InChICode |
InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26-,27-,30+/m1/s1 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@@H]([C@H](O1)COC(=O)/C=C/c1ccc(cc1)O)O)O)O)c1ccc(cc1)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Aerva lanata  | Ref. |
| Plantae | Asteraceae | Anaphalis contorta Hooker | Ref. |
| Plantae | Asteraceae | Helichrysum italicum | Ref. |
| Plantae | Cistaceae | Helianthemum glomeratum | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum | Ref. |
| Plantae | Elaeagnaceae | Shepherdia argentea | Ref. |
| Plantae | Fagaceae | Quercus ilex | Ref. |
| Plantae | Fagaceae | Quercus suber | Ref. |
| Plantae | Labiatae | Leonurus heterophyllus | Ref. |
| Plantae | Labiatae | Phlomis spectabilis | Ref. |
| Plantae | Lauraceae | Lindera megaphylla | Ref. |
| Plantae | Malvaceae | Colona auriculata | Ref. |
| Plantae | Malvaceae | Tilia argentea | Ref. |
| Plantae | Malvaceae | Tilia spp. | Ref. |
| Plantae | Melastomataceae | Miconia cabucu | Ref. |
| Plantae | Pinaceae | Pinus banksiana | Ref. |
| Plantae | Pinaceae | Pinus contorta | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Rosaceae | Fragaria ananassa | Ref. |
| Plantae | Rosaceae | Polylepis incana | Ref. |
| Plantae | Rosaceae | Potentilla anserina | Ref. |
| Plantae | Rosaceae | Potentilla griffithii var.velutina | Ref. |
| Plantae | Thymelaeaceae | Daphne genkwa | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| - | - | Chamaenerion angustifolium | Ref. |
| - | - | Sparuna apiosyce | Ref. |
|
|
zoom in
| Organism | Leonurus heterophyllus |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Zhong, et al., CTHD, 31, (2000), 488.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Cong, et al., Zhongguo Yaowu Huaxue Zazhi, 13, (2003), 349.
Calixto, et al., Planta Med, 69, (2003), 973.
Tsukamoto, et al., JNP, 67, (2004), 1839.
Kiss, et al., Planta Med, 70, (2004), 919.
Peng, et al., Chinese J of Pharm Analysis, 30, (2010), 633 |
|---|
|
