| Name |
(-)-Michelalbine
Michelalbine
Norushinsunine |
| Formula |
C17H15NO3 |
| Mw |
281.10519335 |
| CAS RN |
3175-84-6 |
| C_ID |
C00027444
, 
|
| InChIKey |
CKIYSMRPIBQTHQ-REIYMHPCNA-N |
| InChICode |
InChI=1S/C17H15NO3/c19-16-11-4-2-1-3-10(11)14-13-9(5-6-18-15(13)16)7-12-17(14)21-8-20-12/h1-4,7,15-16,18-19H,5-6,8H2/t15-,16+/m0/s1 |
| SMILES |
c1ccc2c(c1)c1c3[C@@H]([C@@H]2O)NCCc3cc2c1OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cacans | Ref. |
| Plantae | Annonaceae | Annona cherimola  | Ref. |
| Plantae | Annonaceae | Annona cherimolia | Ref. |
| Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
| Plantae | Annonaceae | Cardiopetalum calophyllum | Ref. |
| Plantae | Annonaceae | Oncodostigma monosperma | Ref. |
| Plantae | Annonaceae | Xylopia parviflora | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
| Plantae | Magnoliaceae | Michelia alba | Ref. |
| Plantae | Menispermaceae | Sinomenium acutum | Ref. |
|
|
zoom in
| Organism | Michelia alba |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Zhang, China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 14, (1998), 53.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Hsieh, et al., Journal of Natural Products, 64, (2001), 1157 |
|---|
|
