Name |
Isovitexin 6-beta-D-Glucopyranosyl-4',5,7-trihydroxyflavone Homovitexin 6-C-beta-D-Glucopyranosylapigenin Saponaretin 6-beta-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C21H20O10 |
Mw |
432.10564686 |
CAS RN |
38953-85-4 |
C_ID |
C00001059
, 
|
InChIKey |
MYXNWGACZJSMBT-XZIDVWOUNA-N |
InChICode |
InChI=1S/C21H20O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21+/m1/s1 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
Plantae | Annonaceae | Hornschuchia citriodora | Ref. |
Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
Plantae | Caryophyllaceae | Drymaria diandra  | Ref. |
Plantae | Chloranthaceae | Ascarina lucida | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hombroniana | Ref. |
Plantae | Commelinaceae | Commelina communis L  | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis (L.)  | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
Plantae | Euphorbiaceae | Cladogynos orientalis | Ref. |
Plantae | Euphorbiaceae | Macaranga tanarius | Ref. |
Plantae | Euphorbiaceae | Strophioblachia fimbricalyx Boerl | Ref. |
Plantae | Fabaceae | Acacia caven  | Ref. |
Plantae | Fabaceae | Acacia furcatispina | Ref. |
Plantae | Fabaceae | Anadenanthera peregrina  | Ref. |
Plantae | Fabaceae | Crotalaria micans | Ref. |
Plantae | Fabaceae | Crotalaria verrucosa  | Ref. |
Plantae | Fabaceae | Cytisus hirsutus | Ref. |
Plantae | Fabaceae | Dalbergia monetaria  | Ref. |
Plantae | Fabaceae | Desmodium triflorum  | Ref. |
Plantae | Fabaceae | Galactia glaucophylla | Ref. |
Plantae | Fabaceae | Gleditsia japonica  | Ref. |
Plantae | Fabaceae | Gleditsia sinensis  | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
Plantae | Fabaceae | Lespedeza juncea | Ref. |
Plantae | Fabaceae | Lupinus sericeus | Ref. |
Plantae | Fabaceae | Otholobium bracteolatum | Ref. |
Plantae | Fabaceae | Otholobium foliosum | Ref. |
Plantae | Fabaceae | Otholobium fruticans | Ref. |
Plantae | Fabaceae | Otholobium hirtum | Ref. |
Plantae | Fabaceae | Otholobium parviflorum | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Parkinsonia aculeata  | Ref. |
Plantae | Fabaceae | Pisum sativum  | Ref. |
Plantae | Fabaceae | Prosopis alba  | Ref. |
Plantae | Fabaceae | Prosopis argentina | Ref. |
Plantae | Fabaceae | Prosopis chilensis  | Ref. |
Plantae | Fabaceae | Prosopis fiebrigii | Ref. |
Plantae | Fabaceae | Prosopis hassleri | Ref. |
Plantae | Fabaceae | Prosopis kuntzei  | Ref. |
Plantae | Fabaceae | Prosopis nigra  | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Prosopis ruscifolia  | Ref. |
Plantae | Fabaceae | Prosopis strombulifera  | Ref. |
Plantae | Fabaceae | Prosopis vinalillo  | Ref. |
Plantae | Fabaceae | Psophocarpus tetragonolobus  | Ref. |
Plantae | Fabaceae | Psoralea affinis | Ref. |
Plantae | Fabaceae | Psoralea arborea | Ref. |
Plantae | Fabaceae | Psoralea asarina | Ref. |
Plantae | Fabaceae | Psoralea connixa | Ref. |
Plantae | Fabaceae | Psoralea effusa | Ref. |
Plantae | Fabaceae | Psoralea imbricata | Ref. |
Plantae | Fabaceae | Psoralea laxa | Ref. |
Plantae | Fabaceae | Psoralea papillosa | Ref. |
Plantae | Fabaceae | Psoralea ramulosa | Ref. |
Plantae | Fabaceae | Psoralea speciosa | Ref. |
Plantae | Fabaceae | Rhynchosia cana | Ref. |
Plantae | Fabaceae | Rhynchosia capitata | Ref. |
Plantae | Fabaceae | Rhynchosia heynei | Ref. |
Plantae | Fabaceae | Rhynchosia jacobii | Ref. |
Plantae | Fabaceae | Rhynchosia minima  | Ref. |
Plantae | Fabaceae | Rhynchosia rothii | Ref. |
Plantae | Fabaceae | Rhynchosia suaveolens | Ref. |
Plantae | Fabaceae | Securigera varia | Ref. |
Plantae | Fabaceae | Tamarindus indica  | Ref. |
Plantae | Fabaceae | Vicia faba  | Ref. |
Plantae | Fabaceae | Vigna mungo  | Ref. |
Plantae | Fabaceae | Vigna radiata  | Ref. |
Plantae | Gentianaceae | Gentiana algida | Ref. |
Plantae | Gentianaceae | Gentiana argentea | Ref. |
Plantae | Gentianaceae | Gentiana arisanensis | Ref. |
Plantae | Gentianaceae | Gentiana crassicaulis  | Ref. |
Plantae | Gentianaceae | Gentiana decumbers | Ref. |
Plantae | Gentianaceae | Gentiana depressa | Ref. |
Plantae | Gentianaceae | Gentiana elwesii | Ref. |
Plantae | Gentianaceae | Gentiana lawrencei | Ref. |
Plantae | Gentianaceae | Gentiana macrophylla  | Ref. |
Plantae | Gentianaceae | Gentiana officinalis  | Ref. |
Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
Plantae | Gentianaceae | Gentiana prolata | Ref. |
Plantae | Gentianaceae | Gentiana rigescens  | Ref. |
Plantae | Gentianaceae | Gentiana sikkimensis | Ref. |
Plantae | Gentianaceae | Gentiana straminea  | Ref. |
Plantae | Gentianaceae | Gentiana triflora | Ref. |
Plantae | Gentianaceae | Swertia perennis | Ref. |
Plantae | Gentianaceae | Swertia pseudochinensis | Ref. |
Plantae | Gentianaceae | Swertia punicea | Ref. |
Plantae | Gentianaceae | Tripterospermum japonicum | Ref. |
Plantae | Geraniaceae | Geranium phaeum | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
Plantae | Labiatae | Vitex littoralis | Ref. |
Plantae | Labiatae | Vitex lucens | Ref. |
Plantae | Labiatae | Vitex polygama | Ref. |
Plantae | Linaceae | Linum usitatissimum  | Ref. |
Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
Plantae | Palmae | Phoenix hanceana var. formosana | Ref. |
Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
Plantae | Passifloraceae | Passiflora spp. | Ref. |
Plantae | Poaceae | Zea mays  | Ref. |
Plantae | Polygonaceae | Polygonum affine | Ref. |
Plantae | Rubiaceae | Hedyotis dichotoma | Ref. |
Plantae | Smilacaceae | Smilax bracteata | Ref. |
Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE  | Ref. |
Plantae | Thymelaeaceae | Daphne sericea | Ref. |
|
|
zoom in
Organism | Swertia perennis | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Perkin,J.Chem.Soc.,73,(1989),1019
Horowitz,Chem.Ind.(London),(1968),498 |
---|
|