Name |
Isovitexin 6-beta-D-Glucopyranosyl-4',5,7-trihydroxyflavone Homovitexin 6-C-beta-D-Glucopyranosylapigenin Saponaretin 6-beta-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C21H20O10 |
Mw |
432.10564686 |
CAS RN |
38953-85-4 |
C_ID |
C00001059
, 
|
InChIKey |
MYXNWGACZJSMBT-XZIDVWOUNA-N |
InChICode |
InChI=1S/C21H20O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21+/m1/s1 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
Plantae | Annonaceae | Hornschuchia citriodora | Ref. |
Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
Plantae | Caryophyllaceae | Drymaria diandra  | Ref. |
Plantae | Chloranthaceae | Ascarina lucida | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hombroniana | Ref. |
Plantae | Commelinaceae | Commelina communis L  | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis (L.)  | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
Plantae | Euphorbiaceae | Cladogynos orientalis | Ref. |
Plantae | Euphorbiaceae | Macaranga tanarius | Ref. |
Plantae | Euphorbiaceae | Strophioblachia fimbricalyx Boerl | Ref. |
Plantae | Fabaceae | Acacia caven  | Ref. |
Plantae | Fabaceae | Acacia furcatispina | Ref. |
Plantae | Fabaceae | Anadenanthera peregrina  | Ref. |
Plantae | Fabaceae | Crotalaria micans | Ref. |
Plantae | Fabaceae | Crotalaria verrucosa  | Ref. |
Plantae | Fabaceae | Cytisus hirsutus | Ref. |
Plantae | Fabaceae | Dalbergia monetaria  | Ref. |
Plantae | Fabaceae | Desmodium triflorum  | Ref. |
Plantae | Fabaceae | Galactia glaucophylla | Ref. |
Plantae | Fabaceae | Gleditsia japonica  | Ref. |
Plantae | Fabaceae | Gleditsia sinensis  | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
Plantae | Fabaceae | Lespedeza juncea | Ref. |
Plantae | Fabaceae | Lupinus sericeus | Ref. |
Plantae | Fabaceae | Otholobium bracteolatum | Ref. |
Plantae | Fabaceae | Otholobium foliosum | Ref. |
Plantae | Fabaceae | Otholobium fruticans | Ref. |
Plantae | Fabaceae | Otholobium hirtum | Ref. |
Plantae | Fabaceae | Otholobium parviflorum | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Parkinsonia aculeata  | Ref. |
Plantae | Fabaceae | Pisum sativum  | Ref. |
Plantae | Fabaceae | Prosopis alba  | Ref. |
Plantae | Fabaceae | Prosopis argentina | Ref. |
Plantae | Fabaceae | Prosopis chilensis  | Ref. |
Plantae | Fabaceae | Prosopis fiebrigii | Ref. |
Plantae | Fabaceae | Prosopis hassleri | Ref. |
Plantae | Fabaceae | Prosopis kuntzei  | Ref. |
Plantae | Fabaceae | Prosopis nigra  | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Prosopis ruscifolia  | Ref. |
Plantae | Fabaceae | Prosopis strombulifera  | Ref. |
Plantae | Fabaceae | Prosopis vinalillo  | Ref. |
Plantae | Fabaceae | Psophocarpus tetragonolobus  | Ref. |
Plantae | Fabaceae | Psoralea affinis | Ref. |
Plantae | Fabaceae | Psoralea arborea | Ref. |
Plantae | Fabaceae | Psoralea asarina | Ref. |
Plantae | Fabaceae | Psoralea connixa | Ref. |
Plantae | Fabaceae | Psoralea effusa | Ref. |
Plantae | Fabaceae | Psoralea imbricata | Ref. |
Plantae | Fabaceae | Psoralea laxa | Ref. |
Plantae | Fabaceae | Psoralea papillosa | Ref. |
Plantae | Fabaceae | Psoralea ramulosa | Ref. |
Plantae | Fabaceae | Psoralea speciosa | Ref. |
Plantae | Fabaceae | Rhynchosia cana | Ref. |
Plantae | Fabaceae | Rhynchosia capitata | Ref. |
Plantae | Fabaceae | Rhynchosia heynei | Ref. |
Plantae | Fabaceae | Rhynchosia jacobii | Ref. |
Plantae | Fabaceae | Rhynchosia minima  | Ref. |
Plantae | Fabaceae | Rhynchosia rothii | Ref. |
Plantae | Fabaceae | Rhynchosia suaveolens | Ref. |
Plantae | Fabaceae | Securigera varia | Ref. |
Plantae | Fabaceae | Tamarindus indica  | Ref. |
Plantae | Fabaceae | Vicia faba  | Ref. |
Plantae | Fabaceae | Vigna mungo  | Ref. |
Plantae | Fabaceae | Vigna radiata  | Ref. |
Plantae | Gentianaceae | Gentiana algida | Ref. |
Plantae | Gentianaceae | Gentiana argentea | Ref. |
Plantae | Gentianaceae | Gentiana arisanensis | Ref. |
Plantae | Gentianaceae | Gentiana crassicaulis  | Ref. |
Plantae | Gentianaceae | Gentiana decumbers | Ref. |
Plantae | Gentianaceae | Gentiana depressa | Ref. |
Plantae | Gentianaceae | Gentiana elwesii | Ref. |
Plantae | Gentianaceae | Gentiana lawrencei | Ref. |
Plantae | Gentianaceae | Gentiana macrophylla  | Ref. |
Plantae | Gentianaceae | Gentiana officinalis  | Ref. |
Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
Plantae | Gentianaceae | Gentiana prolata | Ref. |
Plantae | Gentianaceae | Gentiana rigescens  | Ref. |
Plantae | Gentianaceae | Gentiana sikkimensis | Ref. |
Plantae | Gentianaceae | Gentiana straminea  | Ref. |
Plantae | Gentianaceae | Gentiana triflora | Ref. |
Plantae | Gentianaceae | Swertia perennis | Ref. |
Plantae | Gentianaceae | Swertia pseudochinensis | Ref. |
Plantae | Gentianaceae | Swertia punicea | Ref. |
Plantae | Gentianaceae | Tripterospermum japonicum | Ref. |
Plantae | Geraniaceae | Geranium phaeum | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
Plantae | Labiatae | Vitex littoralis | Ref. |
Plantae | Labiatae | Vitex lucens | Ref. |
Plantae | Labiatae | Vitex polygama | Ref. |
Plantae | Linaceae | Linum usitatissimum  | Ref. |
Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
Plantae | Palmae | Phoenix hanceana var. formosana | Ref. |
Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
Plantae | Passifloraceae | Passiflora spp. | Ref. |
Plantae | Poaceae | Zea mays  | Ref. |
Plantae | Polygonaceae | Polygonum affine | Ref. |
Plantae | Rubiaceae | Hedyotis dichotoma | Ref. |
Plantae | Smilacaceae | Smilax bracteata | Ref. |
Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE  | Ref. |
Plantae | Thymelaeaceae | Daphne sericea | Ref. |
|
|
zoom in
Organism | Swertia pseudochinensis | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
OTSUKA, et al., Chem Pharm Bull, 49, (2001), 699.
Hsieh, et al., Journal of Natural Products, 67, (2004), 1175 |
---|
|