Name |
Indole-3-carboxylic acid |
Formula |
C9H7NO2 |
Mw |
161.04767848 |
CAS RN |
771-50-6 |
C_ID |
C00000113
,
|
InChIKey |
KMAKOBLIOCQGJP-UHFFFAOYSA-N |
InChICode |
InChI=1S/C9H7NO2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8/h1-5,10H,(H,11,12) |
SMILES |
c1ccc2c(c1)c(c[nH]2)C(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Chalinidae | Haliclona oculata | Ref. |
Chromalveolata | Alariaceae | Undaria pinnatifida | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Chenopodiaceae | Beta vulgaris | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus L. | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Pinaceae | Pinus sylvestris | Ref. |
Plantae | Rosaceae | Pyrus malus | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
- | - | Cephalanceropsis gracilis | Ref. |
|
|
zoom in
Organism | Pyrus malus | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,2,(1992),138A |
---|
|