| Name |
Shikimic acid
Shikimatic acid |
| Formula |
C7H10O5 |
| Mw |
174.05282343 |
| CAS RN |
138-59-0 |
| C_ID |
C00001203
, 
|
| InChIKey |
JXOHGGNKMLTUBP-KFVSRLJTNA-N |
| InChICode |
InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5-,6-/m1/s1 |
| SMILES |
[C@@H]1([C@@H](CC(=C[C@H]1O)C(=O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Alicyclobacillaceae | Alicyclobacillus acidocaldarius | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Bacteria | Streptomycetaceae | Streptomyces collinus | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis | Ref. |
| Plantae | Fabaceae | Glycine max | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hypericaceae | Hypericum beanii | Ref. |
| Plantae | Illiciaceae | Illicium minwanense | Ref. |
| Plantae | Illiciaceae | Illicium religiosum | Ref. |
| Plantae | Labiatae | Ocimum basilicum | Ref. |
| Plantae | Lythraceae | Punica granatum L. | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
| Plantae | Solanaceae | Solanum tuberosum | Ref. |
| Plantae | Taxaceae | Taxus baccata | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica | Ref. |
|
|
zoom in
| Organism | Ginkgo biloba |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., APS, 29, (1994), 693.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
YUAN, et al., Chem Pharm Bull, 53, (2005), 1610 |
|---|
|
