Name |
Ergine Lysergic acid amide ERG |
Formula |
C16H17N3O |
Mw |
267.13716219 |
CAS RN |
478-94-4 |
C_ID |
C00001718
, 
|
InChIKey |
GENAHGKEFJLNJB-JEVNKCSWNA-N |
InChICode |
InChI=1S/C16H17N3O/c1-19-8-10(16(17)20)5-12-11-3-2-4-13-15(11)9(7-18-13)6-14(12)19/h2-5,7,10,14,18H,6,8H2,1H3,(H2,17,20)/t10-,14-/m1/s1 |
SMILES |
[C@H]1(C=C2[C@H](N(C1)C)Cc1c3c2cccc3[nH]c1)C(=O)N |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Bacteria | Nocardiaceae | Rhodococcus erythropolis MTHt3 | Ref. |
Fungi | Clavicipitaceae | Epichloe inebrians e818 | Ref. |
Plantae | Convolvulaceae | Argyreia nervosa  | Ref. |
Plantae | Convolvulaceae | Ipomoea argyrophylla | Ref. |
Plantae | Convolvulaceae | Ipomoea asarifolia  | Ref. |
Plantae | Convolvulaceae | Ipomoea corymbosa | Ref. |
Plantae | Convolvulaceae | Ipomoea tricolor | Ref. |
Plantae | Convolvulaceae | Ipomoea violacea | Ref. |
Plantae | Convolvulaceae | Rivea corymbosa  | Ref. |
Plantae | Poaceae | Paspalum distichum | Ref. |
- | - | Neotyphodium gansuense | Ref. |
- | - | Periglandula ipomoeae lasaF13 | Ref. |
|
|
zoom in
Organism | Paspalum distichum | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003),Indole Alkaloids
Berde,Handbook of Experimental Pharmacology,Springer-Verlag New York,(1978) |
---|
|