| Name |
4-Methoxycinnamaldehyde
p-Methoxycinnamaldehyde |
| Formula |
C10H10O2 |
| Mw |
162.06807956 |
| CAS RN |
1963-36-6 |
| C_ID |
C00002757
, 
|
| InChIKey |
AXCXHFKZHDEKTP-NSCUHMNNSA-N |
| InChICode |
InChI=1S/C10H10O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-8H,1H3/b3-2+ |
| SMILES |
c1c(ccc(c1)/C=C/C=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus gramineus  | Ref. |
| Plantae | Asteraceae | Artemisia dracunculus | Ref. |
| Plantae | Asteraceae | Sphaeranthus indicus | Ref. |
| Plantae | Illiciaceae | Illicium verum | Ref. |
| Plantae | Labiatae | Agastache rugosa | Ref. |
| Plantae | Labiatae | Agastache rugosus | Ref. |
| Plantae | Labiatae | Ocimum basilicum | Ref. |
| Plantae | Piperaceae | Piper philippinum | Ref. |
| Plantae | Plantaginaceae | Limnophila rugosa | Ref. |
| Plantae | Plantaginaceae | Limnophila rugosus | Ref. |
|
|
zoom in
| Organism | Limnophila rugosus |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
