Name |
Izalpinin 7-O-Methylgalangin Galangin 7-methyl ether 3,5-Dihydroxy-7-methoxy-2-phenyl-4H-1-benzopyran-4-one 3,5-Dihydroxy-7-methoxyflavone |
Formula |
C16H12O5 |
Mw |
284.06847349 |
CAS RN |
480-14-8 |
C_ID |
C00004536
,
|
InChIKey |
PVJNLMXWZXXHSZ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O5/c1-20-10-7-11(17)13-12(8-10)21-16(15(19)14(13)18)9-5-3-2-4-6-9/h2-8,17,19H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccccc1)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Cyprinidae | Carassius auratus | Ref. |
Plantae | Asteraceae | Baccharis viminea | Ref. |
Plantae | Asteraceae | Flourensia resinosa | Ref. |
Plantae | Asteraceae | Helichrysum aureum | Ref. |
Plantae | Asteraceae | Olearia nummularifolia | Ref. |
Plantae | Asteraceae | Ozothamnus ledifolius | Ref. |
Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
Plantae | Capparaceae | Capparis tweediana | Ref. |
Plantae | Iridaceae | Iris tenuifolia | Ref. |
Plantae | Myricaceae | Comptonia peregrina | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
Plantae | Pinaceae | Pinus morrisonicola | Ref. |
Plantae | Pteridaceae | Platyzoma microphyllum | Ref. |
Plantae | Zamiaceae | Apis mellifera ligustica | Ref. |
Plantae | Zingiberaceae | Alpinia chinensis | Ref. |
Plantae | Zingiberaceae | Alpinia japonica | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
|
|
zoom in
Organism | Comptonia peregrina | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kimura,Yakugaku Zasshi,55,(1935),229
Goel,Proc.Indian Acad.Sci..Sect. A,47,(1958)191 |
---|
|