Name |
Galangin 3,7-dimethyl ether 3,7-Dimethoxy-5-hydroxyflavone 3,7-Dimethylgalangin 5-Hydroxy-3,7-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
Formula |
C17H14O5 |
Mw |
298.08412356 |
CAS RN |
70786-48-0 |
C_ID |
C00004537
,
|
InChIKey |
OYCOUDKDRFJOCP-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O5/c1-20-11-8-12(18)14-13(9-11)22-16(17(21-2)15(14)19)10-6-4-3-5-7-10/h3-9,18H,1-2H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccccc1)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Pseudognaphalium cheiranthifolium | Ref. |
Plantae | Boraginaceae | Heliotropium huascoense | Ref. |
Plantae | Boraginaceae | Heliotropium huascuense | Ref. |
Plantae | Boraginaceae | Heliotropium megalanthum | Ref. |
Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
Plantae | Escalloniaceae | Escallonia langleyensis | Ref. |
Plantae | Escalloniaceae | Escallonia leucantha | Ref. |
Plantae | Pteridaceae | Cheilanthes kaulfussii | Ref. |
Plantae | Pteridaceae | Notholaena ekmanii | Ref. |
Plantae | Pteridaceae | Notholaena spp. | Ref. |
Plantae | Pteridaceae | Platyzoma microphyllum | Ref. |
Plantae | Zingiberaceae | Boesenbergia pandurata | Ref. |
Plantae | Zingiberaceae | Kaempferia parviflora | Ref. |
|
|
zoom in
Organism | Notholaena spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wollenweber,Flora,168,(1979),138 |
---|
|