Name |
Eupalitin 6,7-Dimethoxy-3,5,4'-trihydroxyflavone Betuletol 3,5-Dihydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one |
Formula |
C17H14O7 |
Mw |
330.0739528 |
CAS RN |
29536-41-2 |
C_ID |
C00004599
,
|
InChIKey |
KWMAWXWUGIEVDG-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O7/c1-22-11-7-10-12(14(20)17(11)23-2)13(19)15(21)16(24-10)8-3-5-9(18)6-4-8/h3-7,18,20-21H,1-2H3 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)O)c1ccc(cc1)O)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Aizoaceae | Sesuvium portulacastrum | Ref. |
Plantae | Asteraceae | Artemisia austriaca | Ref. |
Plantae | Asteraceae | Baccharis pilularis | Ref. |
Plantae | Asteraceae | Baccharis vaccinioides | Ref. |
Plantae | Asteraceae | Brickellia longifolia | Ref. |
Plantae | Asteraceae | Eupatorium areolare | Ref. |
Plantae | Asteraceae | Eupatorium ligustrinum | Ref. |
Plantae | Asteraceae | Heterotheca villosa | Ref. |
Plantae | Asteraceae | Pluchea odorata | Ref. |
Plantae | Asteraceae | Rudbeckia serotina | Ref. |
Plantae | Boraginaceae | Onosma hispida | Ref. |
Plantae | Crassulaceae | Aeonium glutinosum | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
Plantae | Polemoniaceae | Ipomopsis aggregata | Ref. |
|
|
zoom in
Organism | Rudbeckia serotina | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Quijano,Tetrahedron,26,(1970),2851 |
---|
|