| Name |
Morin
3,5,7,2',4'-Pentahydroxyflavonol
2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
480-16-0 |
| C_ID |
C00004624
, 
|
| InChIKey |
YXOLAZRVSSWPPT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccc(cc1O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Lannea coromandelica  | Ref. |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida | Ref. |
| Plantae | Fabaceae | Millettia racemosa | Ref. |
| Plantae | Lauraceae | Machilus bombycina | Ref. |
| Plantae | Moraceae | Artocarpus integrifolia | Ref. |
| Plantae | Moraceae | Chlorophora tinctoria | Ref. |
| Plantae | Moraceae | Morus alba | Ref. |
| Plantae | Moraceae | Morus serrata | Ref. |
| Plantae | Moraceae | Morus tinctoria | Ref. |
| Plantae | Moraceae | Treculia africana | Ref. |
| Plantae | Myrtaceae | Psidium guajava | Ref. |
|
|
zoom in
| Organism | Morus tinctoria |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Calixto, et al., Planta Med, 69, (2003), 973.
Calixto, et al., Planta Med, 70, (2004), 93.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|
