Name |
Quercetin 3,3',4'-trimethyl ether 5,7-Dihydroxy-3,3',4'-trimethoxyflavone 2-(3,4-Dimethoxyphenyl)-5,7-dihydroxy-3-methoxy-4H-1-benzopyran-4-one |
Formula |
C18H16O7 |
Mw |
344.08960287 |
CAS RN |
14549-84-9 |
C_ID |
C00004648
,
|
InChIKey |
TWMBFWDMMIGYEO-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O7/c1-22-12-5-4-9(6-13(12)23-2)17-18(24-3)16(21)15-11(20)7-10(19)8-14(15)25-17/h4-8,19-20H,1-3H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)OC)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ericameria diffusa | Ref. |
Plantae | Asteraceae | Flourensia cernua | Ref. |
Plantae | Asteraceae | Grindelia nana | Ref. |
Plantae | Asteraceae | Grindelia robusta | Ref. |
Plantae | Asteraceae | Pulicaria canariensis | Ref. |
Plantae | Betulaceae | Betula nigra | Ref. |
Plantae | Cistaceae | Cistus spp. | Ref. |
Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
Plantae | Phrymaceae | Mimulus lewisii | Ref. |
Plantae | Solanaceae | Iochroma warscewiczii | Ref. |
Plantae | Solanaceae | Petunia surfinia | Ref. |
Plantae | Velloziaceae | Barbacenia conicostigma | Ref. |
Plantae | Velloziaceae | Barbacenia rubro-virens | Ref. |
- | - | Siegesbeckia jorullensis | Ref. |
|
|
zoom in
Organism | Eriodictyon trichocalyx | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Urbatsch,Phytochem.,15,(1976),440 |
---|
|