| Name |
Isorhamnetin 3-O-beta-glucopyranoside-7-O-alpha-rhamnopyranoside
Isorhamnetin 3-glucoside-7-rhamnoside
Isorhamnetin-3-O-glucosyl-7-O-rhamnoside |
| Formula |
C28H32O16 |
| Mw |
624.16903498 |
| CAS RN |
17331-71-4 |
| C_ID |
C00005557
, 
|
| InChIKey |
NEJKEXUJCSYMCC-SOGSBMQQNA-N |
| InChICode |
InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(40-9)41-11-6-13(31)17-15(7-11)42-25(10-3-4-12(30)14(5-10)39-2)26(20(17)34)44-28-24(38)22(36)19(33)16(8-29)43-28/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3/t9-,16+,18-,19-,21-,22-,23-,24+,27-,28-/m0/s1 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)OC)O)O)O[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Brassicaceae | Cheiranthus cheiri  | Ref. |
| Plantae | Cruciferae | Brassica napus | Ref. |
| Plantae | Cruciferae | Erysimum perofskianum | Ref. |
| Plantae | Cruciferae | Sinapis arvensis | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
| Plantae | Euphorbiaceae | Chrozophora obliqua | Ref. |
| Plantae | Fabaceae | Astragalus adsurgens | Ref. |
| Plantae | Fabaceae | Lathyrus chrysanthus | Ref. |
| Plantae | Liliaceae | Lilium cordatum | Ref. |
| Plantae | Monimiaceae | Peumus boldus | Ref. |
|
|
zoom in
| Organism | Peumus boldus |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Krug,Pharmazie,20(1965),692
Horhammer,Chem.Ber.,100,(1967),2301 |
|---|
|
