Name |
Protopine Biflorine Corydinine Fumarin Fumarine |
Formula |
C20H19NO5 |
Mw |
353.12632273 |
CAS RN |
130-86-9 |
C_ID |
C00001906
,
|
InChIKey |
GPTFURBXHJWNHR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C20H19NO5/c1-21-5-4-13-7-18-19(25-10-24-18)8-14(13)16(22)6-12-2-3-17-20(15(12)9-21)26-11-23-17/h2-3,7-8H,4-6,9-11H2,1H3 |
SMILES |
c12c(cc3c(c1)CCN(Cc1c(CC3=O)ccc3c1OCO3)C)OCO2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Berberidaceae | Nandina domestica | Ref. |
Plantae | Fumariaceae | Corydalis adunca | Ref. |
Plantae | Fumariaceae | Corydalis ambigua var.amurensis | Ref. |
Plantae | Fumariaceae | Corydalis bungeana | Ref. |
Plantae | Fumariaceae | Corydalis caucasia | Ref. |
Plantae | Fumariaceae | Corydalis cava | Ref. |
Plantae | Fumariaceae | Corydalis claviculata | Ref. |
Plantae | Fumariaceae | Corydalis decumbens | Ref. |
Plantae | Fumariaceae | Corydalis esquirolii | Ref. |
Plantae | Fumariaceae | Corydalis gigantea Trautv.et Mey. | Ref. |
Plantae | Fumariaceae | Corydalis glaucescens | Ref. |
Plantae | Fumariaceae | Corydalis gortschakovii | Ref. |
Plantae | Fumariaceae | Corydalis hsuchowensis | Ref. |
Plantae | Fumariaceae | Corydalis intermedia | Ref. |
Plantae | Fumariaceae | Corydalis ledebouriana K.et K. | Ref. |
Plantae | Fumariaceae | Corydalis longicalcarata | Ref. |
Plantae | Fumariaceae | Corydalis majori | Ref. |
Plantae | Fumariaceae | Corydalis nobilis | Ref. |
Plantae | Fumariaceae | Corydalis omeiensis | Ref. |
Plantae | Fumariaceae | Corydalis pallida | Ref. |
Plantae | Fumariaceae | Corydalis pseudoadunca | Ref. |
Plantae | Fumariaceae | Corydalis racemosa | Ref. |
Plantae | Fumariaceae | Corydalis remota | Ref. |
Plantae | Fumariaceae | Corydalis repens | Ref. |
Plantae | Fumariaceae | Corydalis sewerzovii | Ref. |
Plantae | Fumariaceae | Corydalis solida | Ref. |
Plantae | Fumariaceae | Corydalis stricta Steph. | Ref. |
Plantae | Fumariaceae | Corydalis suaveolens | Ref. |
Plantae | Fumariaceae | Corydalis thyrsifolia | Ref. |
Plantae | Fumariaceae | Corydalis turtschaninowii | Ref. |
Plantae | Fumariaceae | Corydalis yanhusuo | Ref. |
Plantae | Fumariaceae | Dicentra spectabilis | Ref. |
Plantae | Fumariaceae | Fumaria parviflora | Ref. |
Plantae | Fumariaceae | Fumaria agraria | Ref. |
Plantae | Fumariaceae | Fumaria bastardii | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria densiflora | Ref. |
Plantae | Fumariaceae | Fumaria indica | Ref. |
Plantae | Fumariaceae | Fumaria muralis | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii | Ref. |
Plantae | Fumariaceae | Hypecoum erectum L. | Ref. |
Plantae | Fumariaceae | Hypecoum leptocarpum | Ref. |
Plantae | Fumariaceae | Hypecoum pendulum L. | Ref. |
Plantae | Fumariaceae | Hypecoum procumbens | Ref. |
Plantae | Fumariaceae | Hypecoum trilobum | Ref. |
Plantae | Fumariaceae | Platycapnos saxicola | Ref. |
Plantae | Fumariaceae | Platycapnos spicata | Ref. |
Plantae | Fumariaceae | Sarcocapnos baetica | Ref. |
Plantae | Fumariaceae | Sarcocapnos enneaphylla | Ref. |
Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
Plantae | Papaveraceae | Arctomecon californica | Ref. |
Plantae | Papaveraceae | Arctomecon humilis | Ref. |
Plantae | Papaveraceae | Arctomecon merrianii | Ref. |
Plantae | Papaveraceae | Argemone mexicana | Ref. |
Plantae | Papaveraceae | Argemone subfusiformia | Ref. |
Plantae | Papaveraceae | Argemone subfusiformis var.subinermis | Ref. |
Plantae | Papaveraceae | Chelidonium majus L. | Ref. |
Plantae | Papaveraceae | Eomecon chionantha | Ref. |
Plantae | Papaveraceae | Eschscholzia californica | Ref. |
Plantae | Papaveraceae | Glaucium arabicum | Ref. |
Plantae | Papaveraceae | Glaucium corniculatum | Ref. |
Plantae | Papaveraceae | Glaucium fimbrilligerum | Ref. |
Plantae | Papaveraceae | Glaucium flavum | Ref. |
Plantae | Papaveraceae | Glaucium grandiflorum | Ref. |
Plantae | Papaveraceae | Hunnemannia fumariaefolia Sweet. | Ref. |
Plantae | Papaveraceae | Macleaya cordata | Ref. |
Plantae | Papaveraceae | Meconopsis cambrica | Ref. |
Plantae | Papaveraceae | Meconopsis robusta | Ref. |
Plantae | Papaveraceae | Papaver albiforum | Ref. |
Plantae | Papaveraceae | Papaver argemone | Ref. |
Plantae | Papaveraceae | Papaver bracteatum | Ref. |
Plantae | Papaveraceae | Papaver californicum | Ref. |
Plantae | Papaveraceae | Papaver confine | Ref. |
Plantae | Papaveraceae | Papaver curviscapum | Ref. |
Plantae | Papaveraceae | Papaver dubium | Ref. |
Plantae | Papaveraceae | Papaver fugax | Ref. |
Plantae | Papaveraceae | Papaver macrostomum | Ref. |
Plantae | Papaveraceae | Papaver orientale L. | Ref. |
Plantae | Papaveraceae | Papaver persicum Lindl. | Ref. |
Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
Plantae | Papaveraceae | Papaver radicatum | Ref. |
Plantae | Papaveraceae | Papaver rhoeas chelidonides | Ref. |
Plantae | Papaveraceae | Papaver rhopalothece | Ref. |
Plantae | Papaveraceae | Papaver somniferum | Ref. |
Plantae | Papaveraceae | Papaver stevenianum | Ref. |
Plantae | Ranunculaceae | Thalictrum atriplex | Ref. |
Plantae | Ranunculaceae | Thalictrum faberi | Ref. |
Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
Plantae | Ranunculaceae | Thalictrum foliolosum | Ref. |
Plantae | Ranunculaceae | Thalictrum gladulosissimum | Ref. |
Plantae | Ranunculaceae | Thalictrum glandulosissimum | Ref. |
Plantae | Ranunculaceae | Thalictrum isopyroides | Ref. |
Plantae | Ranunculaceae | Thalictrum microgyum | Ref. |
Plantae | Ranunculaceae | Thalictrum petaloideum | Ref. |
Plantae | Ranunculaceae | Thalictrum simplex | Ref. |
Plantae | Ranunculaceae | Thalictrum thunbergii | Ref. |
Plantae | Ranunculaceae | Thalictrum triternatum | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Rubiaceae | Gallium aparine | Ref. |
Plantae | Rubiaceae | Oldenlandia biflora | Ref. |
- | - | Chelidonum majus | Ref. |
- | - | Dactylocapnos torulosa | Ref. |
|
|
zoom in
Organism | Thalictrum gladulosissimum | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Zhang, et al., Planta Med, 69, (2003), 148.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|