Name |
Vitexin 8-D-Glucosyl-4',5,7-trihydroxyflavone Apigenin 8-C-glucoside 8-beta-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C21H20O10 |
Mw |
432.10564686 |
CAS RN |
3681-93-4 |
C_ID |
C00001110
,
|
InChIKey |
SGEWCQFRYRRZDC-RJFRUACSNA-N |
InChICode |
InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17+,18-,19+,21-/m0/s1 |
SMILES |
c1(cc(c2c(c1[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O)oc(cc2=O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
Plantae | Araceae | Anthurium versicolor | Ref. |
Plantae | Cannabaceae | Humulus japonicus | Ref. |
Plantae | Caryophyllaceae | Lychnis flos-cuculi L. | Ref. |
Plantae | Caryophyllaceae | Silene brahuica | Ref. |
Plantae | Caryophyllaceae | Silene multijida | Ref. |
Plantae | Caryophyllaceae | Silene repens | Ref. |
Plantae | Caryophyllaceae | Silene supina | Ref. |
Plantae | Caryophyllaceae | Silene turgida | Ref. |
Plantae | Chloranthaceae | Ascarina lucida | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hombroniana | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia purpurea | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia vitiens | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus | Ref. |
Plantae | Combretaceae | Combretum quadrangulare | Ref. |
Plantae | Commelinaceae | Commelina communis L | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Cucurbitaceae | Gynostemma pentaphyllum | Ref. |
Plantae | Cyatheaceae | Cyathea spp. | Ref. |
Plantae | Cyperaceae | Kyllinga brevifolia | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Euphorbiaceae | Euphorbia supina Rafin | Ref. |
Plantae | Fabaceae | Acacia furcatispina | Ref. |
Plantae | Fabaceae | Acacia praecox | Ref. |
Plantae | Fabaceae | Anthyllis subsimplex | Ref. |
Plantae | Fabaceae | Crotalaria micans | Ref. |
Plantae | Fabaceae | Crotalaria pallida | Ref. |
Plantae | Fabaceae | Crotalaria rotundifolia | Ref. |
Plantae | Fabaceae | Crotalaria verrucosa | Ref. |
Plantae | Fabaceae | Cytisus eriocarpus | Ref. |
Plantae | Fabaceae | Cytisus hirsutus | Ref. |
Plantae | Fabaceae | Cytisus scoparius | Ref. |
Plantae | Fabaceae | Desmodium triflorum | Ref. |
Plantae | Fabaceae | Galactia glaucophylla | Ref. |
Plantae | Fabaceae | Gleditsia japonica | Ref. |
Plantae | Fabaceae | Gleditsia sinensis | Ref. |
Plantae | Fabaceae | Gleditsia triacanthos | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza echinata | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Fabaceae | Lespedeza cuneata | Ref. |
Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
Plantae | Fabaceae | Lespedeza juncea | Ref. |
Plantae | Fabaceae | Lespedeza spp. | Ref. |
Plantae | Fabaceae | Lupinus arboreus | Ref. |
Plantae | Fabaceae | Lupinus sericeus | Ref. |
Plantae | Fabaceae | Lupinus subcarnosus | Ref. |
Plantae | Fabaceae | Lupinus texensis | Ref. |
Plantae | Fabaceae | Medicago medicaginoides | Ref. |
Plantae | Fabaceae | Onobrychis angustifolia | Ref. |
Plantae | Fabaceae | Ononis spinosa | Ref. |
Plantae | Fabaceae | Parkinsonia aculeata | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Prosopis alba | Ref. |
Plantae | Fabaceae | Prosopis argentina | Ref. |
Plantae | Fabaceae | Prosopis chilensis | Ref. |
Plantae | Fabaceae | Prosopis fiebrigii | Ref. |
Plantae | Fabaceae | Prosopis hassleri | Ref. |
Plantae | Fabaceae | Prosopis kuntzei | Ref. |
Plantae | Fabaceae | Prosopis nigra | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Prosopis ruscifolia | Ref. |
Plantae | Fabaceae | Prosopis spp. | Ref. |
Plantae | Fabaceae | Prosopis strombulifera | Ref. |
Plantae | Fabaceae | Prosopis vinalillo | Ref. |
Plantae | Fabaceae | Rhynchosia beddomei | Ref. |
Plantae | Fabaceae | Rhynchosia cana | Ref. |
Plantae | Fabaceae | Rhynchosia capitata | Ref. |
Plantae | Fabaceae | Rhynchosia heynei | Ref. |
Plantae | Fabaceae | Rhynchosia jacobii | Ref. |
Plantae | Fabaceae | Rhynchosia minima | Ref. |
Plantae | Fabaceae | Rhynchosia rufescens | Ref. |
Plantae | Fabaceae | Rhynchosia suaveolens | Ref. |
Plantae | Fabaceae | Spartium junceum | Ref. |
Plantae | Fabaceae | Tamarindus indica | Ref. |
Plantae | Fabaceae | Trigonella balansae | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Trigonella grandiflora | Ref. |
Plantae | Fabaceae | Vigna mungo | Ref. |
Plantae | Fabaceae | Vigna radiata | Ref. |
Plantae | Fabaceae | Vigna trilobata | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Labiatae | Isodon oresbia | Ref. |
Plantae | Labiatae | Isodon oresbius | Ref. |
Plantae | Labiatae | Salvia blepharophylla | Ref. |
Plantae | Labiatae | Stachys scardica Griseb. | Ref. |
Plantae | Labiatae | Vitex littoralis | Ref. |
Plantae | Labiatae | Vitex lucens | Ref. |
Plantae | Labiatae | Vitex polygama | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Oxalidaceae | Oxalis corniculata | Ref. |
Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
Plantae | Pinaceae | Larix spp. | Ref. |
Plantae | Poaceae | Pennisetum americanum | Ref. |
Plantae | Ranunculaceae | Adonis spp. | Ref. |
Plantae | Ranunculaceae | Trollius chinensis | Ref. |
Plantae | Ranunculaceae | Trollius ledebouri | Ref. |
Plantae | Ranunculaceae | Trollius macropetalus | Ref. |
Plantae | Rosaceae | Crataegus hupehensis | Ref. |
Plantae | Rosaceae | Crataegus kansuensis | Ref. |
Plantae | Rosaceae | Crataegus maximowiczii | Ref. |
Plantae | Rosaceae | Crataegus oxyacantha | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.major | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.pilosula | Ref. |
Plantae | Rosaceae | Crataegus sanguinea | Ref. |
Plantae | Rosaceae | Crataegus scabrifolia | Ref. |
Plantae | Rosaceae | Physocarpus capitatus | Ref. |
Plantae | Smilacaceae | Smilax bracteata | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE | Ref. |
Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
|
|
zoom in
Organism | Adonis spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Perkin,J.Chem.Soc.,73,(1989),1019
Horowitz,Chem.Ind.(London),(1968),498 |
---|
|