Name |
(+)-Ferruginol |
Formula |
C20H30O |
Mw |
286.22966558 |
CAS RN |
514-62-5 |
C_ID |
C00003426
,
|
InChIKey |
QXNWVJOHUAQHLM-HOFUVJEBNA-N |
InChICode |
InChI=1S/C20H30O/c1-13(2)15-11-14-7-8-18-19(3,4)9-6-10-20(18,5)16(14)12-17(15)21/h11-13,18,21H,6-10H2,1-5H3/t18-,20+/m0/s1 |
SMILES |
C1CC([C@H]2[C@](C1)(c1c(CC2)cc(c(c1)O)C(C)C)C)(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cephalotaxaceae | Cephalotaxus harringtonia var.drupacea | Ref. |
Plantae | Cupressaceae | Callitris japonica | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cupressaceae | Juniperus excelsa | Ref. |
Plantae | Cupressaceae | Juniperus formosana Hay.var.concolor Hay | Ref. |
Plantae | Cupressaceae | Juniperus rigida | Ref. |
Plantae | Cupressaceae | Tetraclinis articulata | Ref. |
Plantae | Cupressaceae | Thuja standishii | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
Plantae | Labiatae | Salvia argentea | Ref. |
Plantae | Labiatae | Salvia blepharochaena Hedge and Hub.Mor. | Ref. |
Plantae | Labiatae | Salvia blepharochlaena | Ref. |
Plantae | Labiatae | Salvia bracteata Banks and Sol. | Ref. |
Plantae | Labiatae | Salvia caespitosa Montbret and Aucher ex.Bentham | Ref. |
Plantae | Labiatae | Salvia ceratophylla L. | Ref. |
Plantae | Labiatae | Salvia eriophora Boiss and Kotschy | Ref. |
Plantae | Labiatae | Salvia miltiorrhiza | Ref. |
Plantae | Labiatae | Salvia multicaulis | Ref. |
Plantae | Labiatae | Salvia przewalskii | Ref. |
Plantae | Labiatae | Salvia recognita Fisch.et Mey. | Ref. |
Plantae | Labiatae | Salvia staminea | Ref. |
Plantae | Labiatae | Salvia syriaca L. | Ref. |
Plantae | Labiatae | Salvia trijuga | Ref. |
Plantae | Labiatae | Salvia viridis L. | Ref. |
Plantae | Pedaliaceae | Harpagophytum procumbens | Ref. |
Plantae | Podocarpaceae | Podocarpus ferrugineus | Ref. |
Plantae | Taxaceae | Torreya nucifera var.radicans | Ref. |
Plantae | Taxodiaceae | Cryptomeria japonica D.DON. | Ref. |
Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
|
|
zoom in
|